Compound Q&A

What precautions should be taken when handling 1,4-Phenylenebis[(4-fluorophenyl)methanone] (CAS: 68418-51-9)?

Answer

1,4-Phenylenebis[(4-fluorophenyl)methanone]
When handling 1,4-Phenylenebis[(4-fluorophenyl)methanone], it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a dry, well-ventilated area away from heat sources and oxidizers. In case of a spill, it should be handled under a fume hood, and appropriate cleanup procedures should be followed. Always consult the Safety Data Sheet (SDS) for detailed handling and safety information.

About

CAS No 68418-51-9
English Name 1,4-Phenylenebis[(4-fluorophenyl)methanone]
Molecular Formula C20H12F2O2
Molecular Weight 220.22 g/mol
SMILES C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)F)C(=O)C3=CC=C(C=C3)F
InChIKey LLJNTLUXOZPFQB-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-Phenylenebis[(4-fluorophenyl)methanone] (CAS: 68418-51-9)?

1,4-Phenylenebis[(4-fluorophenyl)methanone] is a crystalline compound with a molecular weight of app...

Compound Q&A

How is 1,4-Phenylenebis[(4-fluorophenyl)methanone] (CAS: 68418-51-9) typically synthesized?

1,4-Phenylenebis[(4-fluorophenyl)methanone] is typically synthesized via the condensation of 4-fluor...

Compound Q&A

What industries use 1,4-Phenylenebis[(4-fluorophenyl)methanone] (CAS: 68418-51-9)?

1,4-Phenylenebis[(4-fluorophenyl)methanone] is used in various industries. It is particularly valuab...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...