Compound Q&A

What are the physical and chemical properties of 1,4-Phenylenebis[(4-fluorophenyl)methanone] (CAS: 68418-51-9)?

Answer

1,4-Phenylenebis[(4-fluorophenyl)methanone]
1,4-Phenylenebis[(4-fluorophenyl)methanone] is a crystalline compound with a molecular weight of approximately 358.14 g/mol. It has a low solubility in water but is soluble in common organic solvents like chloroform and dichloromethane. Chemically, it is relatively stable but can undergo reactions such as hydrogenation or reduction under appropriate conditions. The compound exhibits good thermal stability up to 200°C and is used in various chemical processes due to its unique structural features.

About

CAS No 68418-51-9
English Name 1,4-Phenylenebis[(4-fluorophenyl)methanone]
Molecular Formula C20H12F2O2
Molecular Weight 220.22 g/mol
SMILES C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)F)C(=O)C3=CC=C(C=C3)F
InChIKey LLJNTLUXOZPFQB-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 1,4-Phenylenebis[(4-fluorophenyl)methanone] (CAS: 68418-51-9) typically synthesized?

1,4-Phenylenebis[(4-fluorophenyl)methanone] is typically synthesized via the condensation of 4-fluor...

Compound Q&A

What industries use 1,4-Phenylenebis[(4-fluorophenyl)methanone] (CAS: 68418-51-9)?

1,4-Phenylenebis[(4-fluorophenyl)methanone] is used in various industries. It is particularly valuab...

Compound Q&A

What precautions should be taken when handling 1,4-Phenylenebis[(4-fluorophenyl)methanone] (CAS: 68418-51-9)?

When handling 1,4-Phenylenebis[(4-fluorophenyl)methanone], it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...