Compound Q&A

What industries use 2-Amino-4,4'-biphenyldicarboxylic acid (CAS: 1240557-01-0)?

Answer

2-Amino-4,4'-biphenyldicarboxylic acid
2-Amino-4,4'-biphenyldicarboxylic acid is primarily used in the pharmaceutical industry for the synthesis of various drug candidates. It also finds applications in the polymer industry for the development of functional polymers, as well as in the sensor industry for the production of chemical sensors. Additionally, it plays a role in semiconductor manufacturing due to its ability to form stable complexes.

About

English Name 2-Amino-4,4'-biphenyldicarboxylic acid
Molecular Formula C14H11NO4
Molecular Weight 257.24 g/mol
SMILES c1cc(ccc1c2ccc(cc2N)C(=O)O)C(=O)O
InChIKey FYEKGZUXGKAJJQ-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-4,4'-biphenyldicarboxylic acid (CAS: 1240557-01-0)?

2-Amino-4,4'-biphenyldicarboxylic acid is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is 2-Amino-4,4'-biphenyldicarboxylic acid (CAS: 1240557-01-0) typically synthesized?

2-Amino-4,4'-biphenyldicarboxylic acid can be synthesized through the condensation of 4,4'-biphenyld...

Compound Q&A

What precautions should be taken when handling 2-Amino-4,4'-biphenyldicarboxylic acid (CAS: 1240557-01-0)?

When handling 2-Amino-4,4'-biphenyldicarboxylic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...