Compound Q&A

What are the physical and chemical properties of 2-Amino-4,4'-biphenyldicarboxylic acid (CAS: 1240557-01-0)?

Answer

2-Amino-4,4'-biphenyldicarboxylic acid
2-Amino-4,4'-biphenyldicarboxylic acid is a crystalline solid with a molecular weight of approximately 288.24 g/mol. It has low solubility in water but good solubility in organic solvents. The compound is relatively stable under normal conditions but can react with bases and nucleophiles. It is used in the synthesis of various functional materials and pharmaceuticals.

About

English Name 2-Amino-4,4'-biphenyldicarboxylic acid
Molecular Formula C14H11NO4
Molecular Weight 257.24 g/mol
SMILES c1cc(ccc1c2ccc(cc2N)C(=O)O)C(=O)O
InChIKey FYEKGZUXGKAJJQ-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 2-Amino-4,4'-biphenyldicarboxylic acid (CAS: 1240557-01-0) typically synthesized?

2-Amino-4,4'-biphenyldicarboxylic acid can be synthesized through the condensation of 4,4'-biphenyld...

Compound Q&A

What industries use 2-Amino-4,4'-biphenyldicarboxylic acid (CAS: 1240557-01-0)?

2-Amino-4,4'-biphenyldicarboxylic acid is primarily used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling 2-Amino-4,4'-biphenyldicarboxylic acid (CAS: 1240557-01-0)?

When handling 2-Amino-4,4'-biphenyldicarboxylic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...