Compound Q&A

How is 2-Amino-4,4'-biphenyldicarboxylic acid (CAS: 1240557-01-0) typically synthesized?

Answer

2-Amino-4,4'-biphenyldicarboxylic acid
2-Amino-4,4'-biphenyldicarboxylic acid can be synthesized through the condensation of 4,4'-biphenyldicarboxylic anhydride with an amino group. Common catalysts include acids like sulfuric acid or p-toluenesulfonic acid, and the reaction is typically conducted under mild conditions to achieve high yield and selectivity. The exact conditions can vary depending on the specific requirements of the synthesis.

About

English Name 2-Amino-4,4'-biphenyldicarboxylic acid
Molecular Formula C14H11NO4
Molecular Weight 257.24 g/mol
SMILES c1cc(ccc1c2ccc(cc2N)C(=O)O)C(=O)O
InChIKey FYEKGZUXGKAJJQ-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-4,4'-biphenyldicarboxylic acid (CAS: 1240557-01-0)?

2-Amino-4,4'-biphenyldicarboxylic acid is a crystalline solid with a molecular weight of approximate...

Compound Q&A

What industries use 2-Amino-4,4'-biphenyldicarboxylic acid (CAS: 1240557-01-0)?

2-Amino-4,4'-biphenyldicarboxylic acid is primarily used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling 2-Amino-4,4'-biphenyldicarboxylic acid (CAS: 1240557-01-0)?

When handling 2-Amino-4,4'-biphenyldicarboxylic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...