Compound Q&A

What precautions should be taken when handling 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7)?

Answer

1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione
When handling 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7), it is crucial to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be immediately cleaned up using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed safety information and guidelines.

About

English Name 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione
Molecular Formula C11H5F4N4O4
Molecular Weight 332.17 g/mol
SMILES C1CC(=O)N(C1=O)OC(=O)C2=C(C(=C(C(=C2F)F)N=[N+]=[N-])F)F
InChIKey HCTLWQSYGIBOFM-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7)?

1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7) is a crystalline...

Compound Q&A

How is 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7) typically synthesized?

1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7) can be synthesiz...

Compound Q&A

What industries use 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7)?

1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7) is primarily use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...