Compound Q&A

What are the physical and chemical properties of 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7)?

Answer

1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione
1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7) is a crystalline compound with a molecular weight of approximately 517.91 g/mol. It is poorly soluble in water but soluble in organic solvents like DMSO and DMF. This compound is highly reactive due to the azido group and the presence of fluorine atoms, making it susceptible to hydrolysis and nucleophilic substitution reactions.

About

English Name 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione
Molecular Formula C11H5F4N4O4
Molecular Weight 332.17 g/mol
SMILES C1CC(=O)N(C1=O)OC(=O)C2=C(C(=C(C(=C2F)F)N=[N+]=[N-])F)F
InChIKey HCTLWQSYGIBOFM-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7) typically synthesized?

1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7) can be synthesiz...

Compound Q&A

What industries use 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7)?

1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7) is primarily use...

Compound Q&A

What precautions should be taken when handling 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7)?

When handling 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...