Compound Q&A

What industries use 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7)?

Answer

1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione
1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7) is primarily used in the pharmaceutical industry for its azido group, which can be used in medicinal chemistry for the development of drugs. It is also of interest in the polymer industry for its fluorinated backbone and in the semiconductor industry for its use in photoresists and other electronic applications.

About

English Name 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione
Molecular Formula C11H5F4N4O4
Molecular Weight 332.17 g/mol
SMILES C1CC(=O)N(C1=O)OC(=O)C2=C(C(=C(C(=C2F)F)N=[N+]=[N-])F)F
InChIKey HCTLWQSYGIBOFM-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7)?

1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7) is a crystalline...

Compound Q&A

How is 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7) typically synthesized?

1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7) can be synthesiz...

Compound Q&A

What precautions should be taken when handling 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7)?

When handling 1-[(4-Azido-2,3,5,6-tetrafluorobenzoyl)oxy]-2,5-pyrrolidinedione (CAS: 126695-58-7), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...