Compound Q&A

What industries use Vinaginsenoside R8 (CAS: 156042-22-7)?

Answer

Vinaginsenoside R8
Vinaginsenoside R8 is primarily used in the pharmaceutical industry for its potential health benefits. It is also of interest in the food industry as a functional food ingredient. Additionally, it may have applications in the cosmetic industry for skin care products, although more research is needed to fully explore these possibilities.

About

English Name Vinaginsenoside R8
Molecular Formula C48H82O19
Molecular Weight 963.15 g/mol
SMILES OCC1OC(OC2CCC3(C(C2(C)C)CCC2(C3CC(O)C3C2(C)CCC3C(OC2OC(CO)C(C(C2O)O)O)(C/C=C/C(O)(C)C)C)C)C)C(C(C1O)O)OC1OC(CO)C(C(C1O)O)O
InChIKey IAEZLXLDZBZQPU-UKTHLTGXSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Vinaginsenoside R8 (CAS: 156042-22-7)?

Vinaginsenoside R8 is a crystalline compound with a molecular weight of approximately 1333.75 g/mol....

Compound Q&A

How is Vinaginsenoside R8 (CAS: 156042-22-7) typically synthesized?

Vinaginsenoside R8 is typically synthesized through a series of chemical reactions involving the mod...

Compound Q&A

What precautions should be taken when handling Vinaginsenoside R8 (CAS: 156042-22-7)?

When handling Vinaginsenoside R8, it is important to use personal protective equipment (PPE) such as...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...