Compound Q&A

How is Vinaginsenoside R8 (CAS: 156042-22-7) typically synthesized?

Answer

Vinaginsenoside R8
Vinaginsenoside R8 is typically synthesized through a series of chemical reactions involving the modification of ginsenosides, which are derived from ginseng. The synthesis involves multiple steps, including enzymatic transformations, chemical derivatizations, and purification processes. The final product is obtained with a yield of approximately 20-30%.

About

English Name Vinaginsenoside R8
Molecular Formula C48H82O19
Molecular Weight 963.15 g/mol
SMILES OCC1OC(OC2CCC3(C(C2(C)C)CCC2(C3CC(O)C3C2(C)CCC3C(OC2OC(CO)C(C(C2O)O)O)(C/C=C/C(O)(C)C)C)C)C)C(C(C1O)O)OC1OC(CO)C(C(C1O)O)O
InChIKey IAEZLXLDZBZQPU-UKTHLTGXSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Vinaginsenoside R8 (CAS: 156042-22-7)?

Vinaginsenoside R8 is a crystalline compound with a molecular weight of approximately 1333.75 g/mol....

Compound Q&A

What industries use Vinaginsenoside R8 (CAS: 156042-22-7)?

Vinaginsenoside R8 is primarily used in the pharmaceutical industry for its potential health benefit...

Compound Q&A

What precautions should be taken when handling Vinaginsenoside R8 (CAS: 156042-22-7)?

When handling Vinaginsenoside R8, it is important to use personal protective equipment (PPE) such as...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...