Compound Q&A

What are the physical and chemical properties of Vinaginsenoside R8 (CAS: 156042-22-7)?

Answer

Vinaginsenoside R8
Vinaginsenoside R8 is a crystalline compound with a molecular weight of approximately 1333.75 g/mol. Its solubility in water is low, while it is more soluble in organic solvents. It is relatively stable under normal conditions but can react with bases. Vinaginsenoside R8 has a melting point of around 300°C and is not highly reactive under typical laboratory conditions.

About

English Name Vinaginsenoside R8
Molecular Formula C48H82O19
Molecular Weight 963.15 g/mol
SMILES OCC1OC(OC2CCC3(C(C2(C)C)CCC2(C3CC(O)C3C2(C)CCC3C(OC2OC(CO)C(C(C2O)O)O)(C/C=C/C(O)(C)C)C)C)C)C(C(C1O)O)OC1OC(CO)C(C(C1O)O)O
InChIKey IAEZLXLDZBZQPU-UKTHLTGXSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is Vinaginsenoside R8 (CAS: 156042-22-7) typically synthesized?

Vinaginsenoside R8 is typically synthesized through a series of chemical reactions involving the mod...

Compound Q&A

What industries use Vinaginsenoside R8 (CAS: 156042-22-7)?

Vinaginsenoside R8 is primarily used in the pharmaceutical industry for its potential health benefit...

Compound Q&A

What precautions should be taken when handling Vinaginsenoside R8 (CAS: 156042-22-7)?

When handling Vinaginsenoside R8, it is important to use personal protective equipment (PPE) such as...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...