Compound Q&A

What industries use 2-Isopropoxy-1,3-diisopropylbenzene (CAS: 141214-18-8)?

Answer

2-Isopropoxy-1,3-diisopropylbenzene
2-Isopropoxy-1,3-diisopropylbenzene is primarily used in the pharmaceutical industry as a precursor for the synthesis of certain drugs. It is also utilized in the polymer industry to enhance the properties of polymers. Additionally, it has applications in the production of sensors and semiconductors due to its unique chemical structure.

About

English Name 2-Isopropoxy-1,3-diisopropylbenzene
Molecular Formula C15H24O
Molecular Weight 220.36 g/mol
SMILES CC(C)c1cccc(c1OC(C)C)C(C)C
InChIKey APXUVWNNDMEOEC-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Isopropoxy-1,3-diisopropylbenzene (CAS: 141214-18-8)?

2-Isopropoxy-1,3-diisopropylbenzene is a colorless liquid with a molecular weight of approximately 2...

Compound Q&A

How is 2-Isopropoxy-1,3-diisopropylbenzene (CAS: 141214-18-8) typically synthesized?

2-Isopropoxy-1,3-diisopropylbenzene is typically synthesized via the Friedel-Crafts alkylation of to...

Compound Q&A

What precautions should be taken when handling 2-Isopropoxy-1,3-diisopropylbenzene (CAS: 141214-18-8)?

When handling 2-Isopropoxy-1,3-diisopropylbenzene, it is important to use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...