Compound Q&A

What are the physical and chemical properties of 2-Isopropoxy-1,3-diisopropylbenzene (CAS: 141214-18-8)?

Answer

2-Isopropoxy-1,3-diisopropylbenzene
2-Isopropoxy-1,3-diisopropylbenzene is a colorless liquid with a molecular weight of approximately 282.4 g/mol. It has a low solubility in water but is miscible with organic solvents. This compound is relatively stable under normal conditions but can react with strong oxidizing agents. It is used in various industrial applications due to its reactivity and chemical stability.

About

English Name 2-Isopropoxy-1,3-diisopropylbenzene
Molecular Formula C15H24O
Molecular Weight 220.36 g/mol
SMILES CC(C)c1cccc(c1OC(C)C)C(C)C
InChIKey APXUVWNNDMEOEC-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 2-Isopropoxy-1,3-diisopropylbenzene (CAS: 141214-18-8) typically synthesized?

2-Isopropoxy-1,3-diisopropylbenzene is typically synthesized via the Friedel-Crafts alkylation of to...

Compound Q&A

What industries use 2-Isopropoxy-1,3-diisopropylbenzene (CAS: 141214-18-8)?

2-Isopropoxy-1,3-diisopropylbenzene is primarily used in the pharmaceutical industry as a precursor ...

Compound Q&A

What precautions should be taken when handling 2-Isopropoxy-1,3-diisopropylbenzene (CAS: 141214-18-8)?

When handling 2-Isopropoxy-1,3-diisopropylbenzene, it is important to use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...