Compound Q&A

How is 2-Isopropoxy-1,3-diisopropylbenzene (CAS: 141214-18-8) typically synthesized?

Answer

2-Isopropoxy-1,3-diisopropylbenzene
2-Isopropoxy-1,3-diisopropylbenzene is typically synthesized via the Friedel-Crafts alkylation of toluene with isopropyl bromide in the presence of aluminum chloride as a catalyst. The reaction involves the selective introduction of alkyl groups, yielding a high yield of the desired product.

About

English Name 2-Isopropoxy-1,3-diisopropylbenzene
Molecular Formula C15H24O
Molecular Weight 220.36 g/mol
SMILES CC(C)c1cccc(c1OC(C)C)C(C)C
InChIKey APXUVWNNDMEOEC-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Isopropoxy-1,3-diisopropylbenzene (CAS: 141214-18-8)?

2-Isopropoxy-1,3-diisopropylbenzene is a colorless liquid with a molecular weight of approximately 2...

Compound Q&A

What industries use 2-Isopropoxy-1,3-diisopropylbenzene (CAS: 141214-18-8)?

2-Isopropoxy-1,3-diisopropylbenzene is primarily used in the pharmaceutical industry as a precursor ...

Compound Q&A

What precautions should be taken when handling 2-Isopropoxy-1,3-diisopropylbenzene (CAS: 141214-18-8)?

When handling 2-Isopropoxy-1,3-diisopropylbenzene, it is important to use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...