Compound Q&A

What precautions should be taken when handling (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5)?

Answer

[2-Fluoro-6-(trifluoromethyl)phenyl]boronic acid
When handling (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5), it is essential to use appropriate personal protective equipment, including gloves, safety goggles, and a lab coat. Work must be performed in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up with care, and the material safety data sheet (MSDS) should be consulted for specific spill procedures. Ensure proper storage in a secure, cool, and dry location away from flammable materials.

About

English Name [2-Fluoro-6-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C7H5BF4O2
Molecular Weight 207.92 g/mol
SMILES B(C1=C(C=CC=C1F)C(F)(F)F)(O)O
InChIKey TXBRJTKFAYXKMV-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5)?

(2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5) is a crystalline solid with a mo...

Compound Q&A

How is (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5) typically synthesized?

(2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5) can be synthesized through a two...

Compound Q&A

What industries use (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5)?

(2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5) is widely used in the pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...