Compound Q&A

What industries use (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5)?

Answer

[2-Fluoro-6-(trifluoromethyl)phenyl]boronic acid
(2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5) is widely used in the pharmaceutical industry for the synthesis of drug intermediates due to its reactivity in coupling reactions. It also finds applications in the polymer industry for the modification of polymers, in sensor technology for detection of specific analytes, and in semiconductor manufacturing for material preparation.

About

English Name [2-Fluoro-6-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C7H5BF4O2
Molecular Weight 207.92 g/mol
SMILES B(C1=C(C=CC=C1F)C(F)(F)F)(O)O
InChIKey TXBRJTKFAYXKMV-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5)?

(2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5) is a crystalline solid with a mo...

Compound Q&A

How is (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5) typically synthesized?

(2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5) can be synthesized through a two...

Compound Q&A

What precautions should be taken when handling (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5)?

When handling (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...