Compound Q&A

What are the physical and chemical properties of (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5)?

Answer

[2-Fluoro-6-(trifluoromethyl)phenyl]boronic acid
(2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5) is a crystalline solid with a molecular weight of approximately 342.11 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. This compound is known for its high reactivity, particularly in Suzuki coupling reactions, and is often used as a boronic acid derivative in organic synthesis.

About

English Name [2-Fluoro-6-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C7H5BF4O2
Molecular Weight 207.92 g/mol
SMILES B(C1=C(C=CC=C1F)C(F)(F)F)(O)O
InChIKey TXBRJTKFAYXKMV-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5) typically synthesized?

(2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5) can be synthesized through a two...

Compound Q&A

What industries use (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5)?

(2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5) is widely used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5)?

When handling (2-Fluoro-6-(trifluoromethyl)phenyl)boronic acid (CAS: 313545-34-5), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...