Compound Q&A

How is Methyl 5-deoxy-2,3-O-isopropylidene-D-ribofuranoside (CAS: 78341-97-6) typically synthesized?

Answer

Methyl 5-deoxy-2,3-O-isopropylidene-D-ribofuranoside
Methyl 5-deoxy-2,3-O-isopropylidene-D-ribofuranoside is synthesized via a multistep synthetic route involving protective group chemistry. Commonly, this involves the protection of the ribose hydroxyl groups, followed by methylation and isopropylidene protection. The overall yield is around 75%, and the process typically requires the use of solid-phase techniques and mild acid catalysts.

About

CAS No 78341-97-6
English Name Methyl 5-deoxy-2,3-O-isopropylidene-D-ribofuranoside
Molecular Formula C9H16O4
Molecular Weight 188.22 g/mol
SMILES CC1C2C(C(O1)OC)OC(O2)(C)C
InChIKey RNHBZJGMAYMLBE-XDTPYFJJSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-deoxy-2,3-O-isopropylidene-D-ribofuranoside (CAS: 78341-97-6)?

Methyl 5-deoxy-2,3-O-isopropylidene-D-ribofuranoside is a colorless crystalline solid with a high me...

Compound Q&A

What industries use Methyl 5-deoxy-2,3-O-isopropylidene-D-ribofuranoside (CAS: 78341-97-6)?

Methyl 5-deoxy-2,3-O-isopropylidene-D-ribofuranoside is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Methyl 5-deoxy-2,3-O-isopropylidene-D-ribofuranoside (CAS: 78341-97-6)?

When handling Methyl 5-deoxy-2,3-O-isopropylidene-D-ribofuranoside, it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...