Compound Q&A

How is 3,4-Dimethoxybenzamide (CAS: 1521-41-1) typically synthesized?

Answer

3,4-Dimethoxybenzamide
3,4-Dimethoxybenzamide is typically synthesized by the reaction of p-dimethoxybenzoyl chloride with an amine. Common amine substrates include methylamine and ethylamine. The reaction is usually carried out in a solvent such as dichloromethane, with the use of a catalyst like 4-dimethylaminopyridine (DMAP) to improve yield and selectivity. The product is obtained in moderate to good yield, making this method suitable for both academic and industrial applications.

About

CAS No 1521-41-1
English Name 3,4-Dimethoxybenzamide
Molecular Formula C9H11NO3
Molecular Weight 181.19 g/mol
SMILES COC1=C(C=C(C=C1)C(=O)N)OC
InChIKey XNDZRGTVUVVHQT-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,4-Dimethoxybenzamide (CAS: 1521-41-1)?

3,4-Dimethoxybenzamide (CAS: 1521-41-1) is a white crystalline solid with a molecular weight of appr...

Compound Q&A

What industries use 3,4-Dimethoxybenzamide (CAS: 1521-41-1)?

3,4-Dimethoxybenzamide (CAS: 1521-41-1) finds applications in various industries. It is used in phar...

Compound Q&A

What precautions should be taken when handling 3,4-Dimethoxybenzamide (CAS: 1521-41-1)?

When handling 3,4-Dimethoxybenzamide (CAS: 1521-41-1), it is crucial to use appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...