Compound Q&A

What are the physical and chemical properties of 3,4-Dimethoxybenzamide (CAS: 1521-41-1)?

Answer

3,4-Dimethoxybenzamide
3,4-Dimethoxybenzamide (CAS: 1521-41-1) is a white crystalline solid with a molecular weight of approximately 184.19 g/mol. It has a solubility of about 50 mg/mL in water and is soluble in organic solvents like methanol and ethanol. It is stable under normal conditions but can react with strong acids and bases. The compound is not flammable but requires proper handling to avoid potential hazards.

About

CAS No 1521-41-1
English Name 3,4-Dimethoxybenzamide
Molecular Formula C9H11NO3
Molecular Weight 181.19 g/mol
SMILES COC1=C(C=C(C=C1)C(=O)N)OC
InChIKey XNDZRGTVUVVHQT-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 3,4-Dimethoxybenzamide (CAS: 1521-41-1) typically synthesized?

3,4-Dimethoxybenzamide is typically synthesized by the reaction of p-dimethoxybenzoyl chloride with ...

Compound Q&A

What industries use 3,4-Dimethoxybenzamide (CAS: 1521-41-1)?

3,4-Dimethoxybenzamide (CAS: 1521-41-1) finds applications in various industries. It is used in phar...

Compound Q&A

What precautions should be taken when handling 3,4-Dimethoxybenzamide (CAS: 1521-41-1)?

When handling 3,4-Dimethoxybenzamide (CAS: 1521-41-1), it is crucial to use appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...