Compound Q&A

What industries use (2-Chloro-3-quinolinyl)boronic acid (CAS: 128676-84-6)?

Answer

(2-Chloro-3-quinolinyl)boronic acid
(2-Chloro-3-quinolinyl)boronic acid finds applications in the pharmaceutical industry for the synthesis of drug intermediates, in the polymer industry for the modification of materials, and in the sensor industry for the development of chemical sensors. It is also used in semiconductor manufacturing for certain processing steps.

About

English Name (2-Chloro-3-quinolinyl)boronic acid
Molecular Formula C9H7BClNO2
Molecular Weight 207.42 g/mol
SMILES B(C1=CC2=CC=CC=C2N=C1Cl)(O)O
InChIKey JAQXYUOPSOXQCG-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Chloro-3-quinolinyl)boronic acid (CAS: 128676-84-6)?

(2-Chloro-3-quinolinyl)boronic acid is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

How is (2-Chloro-3-quinolinyl)boronic acid (CAS: 128676-84-6) typically synthesized?

(2-Chloro-3-quinolinyl)boronic acid is typically synthesized by the reaction of 3-quinolylboronic ac...

Compound Q&A

What precautions should be taken when handling (2-Chloro-3-quinolinyl)boronic acid (CAS: 128676-84-6)?

When handling (2-Chloro-3-quinolinyl)boronic acid, it is important to wear protective gloves, goggle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...