Compound Q&A

What are the physical and chemical properties of (2-Chloro-3-quinolinyl)boronic acid (CAS: 128676-84-6)?

Answer

(2-Chloro-3-quinolinyl)boronic acid
(2-Chloro-3-quinolinyl)boronic acid is a crystalline solid with a molecular weight of approximately 245.01 g/mol. It has a low solubility in water but is soluble in organic solvents like dichloromethane and ethanol. The compound is known for its reactivity towards boronic acid coupling reactions, commonly used in organic synthesis.

About

English Name (2-Chloro-3-quinolinyl)boronic acid
Molecular Formula C9H7BClNO2
Molecular Weight 207.42 g/mol
SMILES B(C1=CC2=CC=CC=C2N=C1Cl)(O)O
InChIKey JAQXYUOPSOXQCG-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is (2-Chloro-3-quinolinyl)boronic acid (CAS: 128676-84-6) typically synthesized?

(2-Chloro-3-quinolinyl)boronic acid is typically synthesized by the reaction of 3-quinolylboronic ac...

Compound Q&A

What industries use (2-Chloro-3-quinolinyl)boronic acid (CAS: 128676-84-6)?

(2-Chloro-3-quinolinyl)boronic acid finds applications in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling (2-Chloro-3-quinolinyl)boronic acid (CAS: 128676-84-6)?

When handling (2-Chloro-3-quinolinyl)boronic acid, it is important to wear protective gloves, goggle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...