Compound Q&A

How is (2-Chloro-3-quinolinyl)boronic acid (CAS: 128676-84-6) typically synthesized?

Answer

(2-Chloro-3-quinolinyl)boronic acid
(2-Chloro-3-quinolinyl)boronic acid is typically synthesized by the reaction of 3-quinolylboronic acid with chlorine gas in the presence of a catalyst, such as iron(III) chloride. The reaction is selective and yields a high percentage of the desired product, making it a common method in the synthesis of boronic acids.

About

English Name (2-Chloro-3-quinolinyl)boronic acid
Molecular Formula C9H7BClNO2
Molecular Weight 207.42 g/mol
SMILES B(C1=CC2=CC=CC=C2N=C1Cl)(O)O
InChIKey JAQXYUOPSOXQCG-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Chloro-3-quinolinyl)boronic acid (CAS: 128676-84-6)?

(2-Chloro-3-quinolinyl)boronic acid is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

What industries use (2-Chloro-3-quinolinyl)boronic acid (CAS: 128676-84-6)?

(2-Chloro-3-quinolinyl)boronic acid finds applications in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling (2-Chloro-3-quinolinyl)boronic acid (CAS: 128676-84-6)?

When handling (2-Chloro-3-quinolinyl)boronic acid, it is important to wear protective gloves, goggle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...