Compound Q&A

What are the physical and chemical properties of 1',3',3'-Trimethyl-6-nitro-1',3'-dihydrospiro[chromene-2,2'-indole] (CAS: 1498-88-0)?

Answer

1',3',3'-Trimethyl-6-nitro-1',3'-dihydrospiro[chromene-2,2'-indole]
1',3',3'-Trimethyl-6-nitro-1',3'-dihydrospiro[chromene-2,2'-indole] is a crystalline solid with a molecular weight of approximately 314.12 g/mol. It is slightly soluble in organic solvents such as ethanol and acetone. This compound is known for its reactive nature, particularly towards nucleophiles and reducing agents. It exhibits good stability under normal storage conditions but requires care when handling due to its potential reactivity.

About

CAS No 1498-88-0
English Name 1',3',3'-Trimethyl-6-nitro-1',3'-dihydrospiro[chromene-2,2'-indole]
Molecular Formula C19H18N2O3
Molecular Weight 322.36 g/mol
SMILES [O-][N+](=O)c1ccc2c(c1)C=CC1(O2)N(C)c2c(C1(C)C)cccc2
InChIKey PSXPTGAEJZYNFI-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 1',3',3'-Trimethyl-6-nitro-1',3'-dihydrospiro[chromene-2,2'-indole] (CAS: 1498-88-0) typically synthesized?

1',3',3'-Trimethyl-6-nitro-1',3'-dihydrospiro[chromene-2,2'-indole] is typically synthesized via a m...

Compound Q&A

What industries use 1',3',3'-Trimethyl-6-nitro-1',3'-dihydrospiro[chromene-2,2'-indole] (CAS: 1498-88-0)?

1',3',3'-Trimethyl-6-nitro-1',3'-dihydrospiro[chromene-2,2'-indole] has applications in the pharmace...

Compound Q&A

What precautions should be taken when handling 1',3',3'-Trimethyl-6-nitro-1',3'-dihydrospiro[chromene-2,2'-indole] (CAS: 1498-88-0)?

When handling 1',3',3'-Trimethyl-6-nitro-1',3'-dihydrospiro[chromene-2,2'-indole], it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...