Compound Q&A

What precautions should be taken when handling [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4)?

Answer

[3-(Benzylcarbamoyl)phenyl]boronic acid
When handling [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4), it is essential to wear appropriate personal protective equipment (PPE) including safety goggles, gloves, and a lab coat. The compound should be handled in a well-ventilated fume hood to minimize exposure to potential vapors. Spills should be immediately cleaned up using appropriate materials, and the area should be flushed with water. In case of accidental ingestion or skin contact, seek medical attention immediately. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name [3-(Benzylcarbamoyl)phenyl]boronic acid
Molecular Formula C14H14BNO3
Molecular Weight 255.08 g/mol
SMILES B(C1=CC(=CC=C1)C(=O)NCC2=CC=CC=C2)(O)O
InChIKey OBCLAQJSSJOSFL-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4)?

[3-(Benzylcarbamoyl)phenyl]boronic acid is a crystalline compound with a molecular weight of approxi...

Compound Q&A

How is [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4) typically synthesized?

[3-(Benzylcarbamoyl)phenyl]boronic acid is typically synthesized via the protection of a phenolic hy...

Compound Q&A

What industries use [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4)?

[3-(Benzylcarbamoyl)phenyl]boronic acid finds applications across multiple industries. In pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...