Compound Q&A

How is [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4) typically synthesized?

Answer

[3-(Benzylcarbamoyl)phenyl]boronic acid
[3-(Benzylcarbamoyl)phenyl]boronic acid is typically synthesized via the protection of a phenolic hydroxyl group followed by carbamoylation of the benzene ring. The key steps involve the use of a protecting group such as tert-butyldimethylsilyl chloride, followed by the addition of benzyl carbamoyl chloride in the presence of a base like triethylamine. The reaction conditions are optimized to achieve high yield and selectivity. This compound is also available commercially for research and industrial applications.

About

English Name [3-(Benzylcarbamoyl)phenyl]boronic acid
Molecular Formula C14H14BNO3
Molecular Weight 255.08 g/mol
SMILES B(C1=CC(=CC=C1)C(=O)NCC2=CC=CC=C2)(O)O
InChIKey OBCLAQJSSJOSFL-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4)?

[3-(Benzylcarbamoyl)phenyl]boronic acid is a crystalline compound with a molecular weight of approxi...

Compound Q&A

What industries use [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4)?

[3-(Benzylcarbamoyl)phenyl]boronic acid finds applications across multiple industries. In pharmaceut...

Compound Q&A

What precautions should be taken when handling [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4)?

When handling [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...