Compound Q&A

What are the physical and chemical properties of [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4)?

Answer

[3-(Benzylcarbamoyl)phenyl]boronic acid
[3-(Benzylcarbamoyl)phenyl]boronic acid is a crystalline compound with a molecular weight of approximately 348.35 g/mol. It has a moderate solubility in organic solvents like dichloromethane and poor solubility in water. The compound shows high reactivity in boronate ester formation and is stable under acidic conditions but prone to hydrolysis under basic conditions. It is often used in various chemical reactions due to its unique structure and functional groups.

About

English Name [3-(Benzylcarbamoyl)phenyl]boronic acid
Molecular Formula C14H14BNO3
Molecular Weight 255.08 g/mol
SMILES B(C1=CC(=CC=C1)C(=O)NCC2=CC=CC=C2)(O)O
InChIKey OBCLAQJSSJOSFL-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4) typically synthesized?

[3-(Benzylcarbamoyl)phenyl]boronic acid is typically synthesized via the protection of a phenolic hy...

Compound Q&A

What industries use [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4)?

[3-(Benzylcarbamoyl)phenyl]boronic acid finds applications across multiple industries. In pharmaceut...

Compound Q&A

What precautions should be taken when handling [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4)?

When handling [3-(Benzylcarbamoyl)phenyl]boronic acid (CAS: 625470-96-4), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...