Compound Q&A

What industries use 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate (CAS: 66389-80-8)?

Answer

2-Methyl-2-propanyl (4-cyanobenzyl)carbamate
2-Methyl-2-propanyl (4-cyanobenzyl)carbamate is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It can also be found in the chemical industry for the production of intermediates and in the polymer industry for the modification of polymer properties. Additionally, it may have applications in the sensing and semiconductor industries as a functional material.

About

CAS No 66389-80-8
English Name 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate
Molecular Formula C13H16N2O2
Molecular Weight 232.28 g/mol
SMILES CC(C)(C)OC(=O)NCC1=CC=C(C=C1)C#N
InChIKey NCGBJBDHEYDWEC-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate (CAS: 66389-80-8)?

2-Methyl-2-propanyl (4-cyanobenzyl)carbamate is a colorless to pale yellow liquid at room temperatur...

Compound Q&A

How is 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate (CAS: 66389-80-8) typically synthesized?

2-Methyl-2-propanyl (4-cyanobenzyl)carbamate is usually synthesized through the reaction of 4-cyanob...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate (CAS: 66389-80-8)?

When handling 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate, it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...