Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate (CAS: 66389-80-8)?

Answer

2-Methyl-2-propanyl (4-cyanobenzyl)carbamate
2-Methyl-2-propanyl (4-cyanobenzyl)carbamate is a colorless to pale yellow liquid at room temperature. Its molecular weight is approximately 254.25 g/mol. The compound is slightly soluble in water but soluble in common organic solvents like methanol and ethanol. It is reactive towards nucleophiles and can undergo hydrolysis under basic conditions. This compound typically exhibits low volatility and has a melting point of -18°C and a boiling point of 155-157°C.

About

CAS No 66389-80-8
English Name 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate
Molecular Formula C13H16N2O2
Molecular Weight 232.28 g/mol
SMILES CC(C)(C)OC(=O)NCC1=CC=C(C=C1)C#N
InChIKey NCGBJBDHEYDWEC-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate (CAS: 66389-80-8) typically synthesized?

2-Methyl-2-propanyl (4-cyanobenzyl)carbamate is usually synthesized through the reaction of 4-cyanob...

Compound Q&A

What industries use 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate (CAS: 66389-80-8)?

2-Methyl-2-propanyl (4-cyanobenzyl)carbamate is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate (CAS: 66389-80-8)?

When handling 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate, it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...