Compound Q&A

How is 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate (CAS: 66389-80-8) typically synthesized?

Answer

2-Methyl-2-propanyl (4-cyanobenzyl)carbamate
2-Methyl-2-propanyl (4-cyanobenzyl)carbamate is usually synthesized through the reaction of 4-cyanobenzyl chlorides with 2-methyl-2-propanol in the presence of a base like triethylamine. The reaction typically proceeds with good yield and selectivity. The exact conditions, such as temperature and solvent, can vary depending on the specific starting materials and desired purity of the product.

About

CAS No 66389-80-8
English Name 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate
Molecular Formula C13H16N2O2
Molecular Weight 232.28 g/mol
SMILES CC(C)(C)OC(=O)NCC1=CC=C(C=C1)C#N
InChIKey NCGBJBDHEYDWEC-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate (CAS: 66389-80-8)?

2-Methyl-2-propanyl (4-cyanobenzyl)carbamate is a colorless to pale yellow liquid at room temperatur...

Compound Q&A

What industries use 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate (CAS: 66389-80-8)?

2-Methyl-2-propanyl (4-cyanobenzyl)carbamate is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate (CAS: 66389-80-8)?

When handling 2-Methyl-2-propanyl (4-cyanobenzyl)carbamate, it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...