Compound Q&A

What industries use 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid (CAS: 756525-98-1)?

Answer

3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid
This compound is primarily used in the pharmaceutical industry for its potential as a drug intermediate. It may also find applications in polymer chemistry for functionalization of polymer chains, and in sensor technology for use in sensing devices. Its unique chemical structure may also be of interest in semiconductor manufacturing for specific applications.

About

English Name 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid
Molecular Formula C14H20N2O7
Molecular Weight 328.32 g/mol
SMILES O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCC(=O)O
InChIKey GBPJQBDDYXDSNH-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid (CAS: 756525-98-1)?

The compound is a white crystalline solid with a molecular weight of approximately 418.48 g/mol. It ...

Compound Q&A

How is 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid (CAS: 756525-98-1) typically synthesized?

This compound can be synthesized via a multi-step process involving the condensation of a pyrrole de...

Compound Q&A

What precautions should be taken when handling 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid (CAS: 756525-98-1)?

When handling this compound, appropriate Personal Protective Equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...