Compound Q&A

How is 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid (CAS: 756525-98-1) typically synthesized?

Answer

3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid
This compound can be synthesized via a multi-step process involving the condensation of a pyrrole derivative with an amino acid, followed by derivatization with ethylene glycol and further acylation. Common synthetic methods include the use of coupling reagents like DCC and HOBt, with high yield and selectivity. The reaction conditions should be carefully controlled to avoid side reactions.

About

English Name 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid
Molecular Formula C14H20N2O7
Molecular Weight 328.32 g/mol
SMILES O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCC(=O)O
InChIKey GBPJQBDDYXDSNH-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid (CAS: 756525-98-1)?

The compound is a white crystalline solid with a molecular weight of approximately 418.48 g/mol. It ...

Compound Q&A

What industries use 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid (CAS: 756525-98-1)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug intermedi...

Compound Q&A

What precautions should be taken when handling 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid (CAS: 756525-98-1)?

When handling this compound, appropriate Personal Protective Equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...