Compound Q&A

What are the physical and chemical properties of 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid (CAS: 756525-98-1)?

Answer

3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid
The compound is a white crystalline solid with a molecular weight of approximately 418.48 g/mol. It is slightly soluble in water and more soluble in organic solvents. Chemically, it is a carboxylic acid with potential reactivity in both acidic and basic conditions. It can form salts and esters, and its stability is affected by moisture and heat.

About

English Name 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid
Molecular Formula C14H20N2O7
Molecular Weight 328.32 g/mol
SMILES O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCC(=O)O
InChIKey GBPJQBDDYXDSNH-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid (CAS: 756525-98-1) typically synthesized?

This compound can be synthesized via a multi-step process involving the condensation of a pyrrole de...

Compound Q&A

What industries use 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid (CAS: 756525-98-1)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug intermedi...

Compound Q&A

What precautions should be taken when handling 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid (CAS: 756525-98-1)?

When handling this compound, appropriate Personal Protective Equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...