Compound Q&A

What are the physical and chemical properties of 3',6'-Dihydroxy-6-nitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one (CAS: 27402-68-2)?

Answer

3',6'-Dihydroxy-6-nitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one
3',6'-Dihydroxy-6-nitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one (CAS: 27402-68-2) is a crystalline compound with a molecular weight of approximately 354.12 g/mol. It is slightly soluble in water and more soluble in organic solvents like methanol and ethanol. The compound is known for its acidity and reactivity towards nucleophiles. It is stable under neutral to slightly acidic conditions, but may decompose at elevated temperatures or in basic solutions.

About

CAS No 27402-68-2
English Name 3',6'-Dihydroxy-6-nitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one
Molecular Formula C20H11NO7
Molecular Weight 377.3 g/mol
SMILES C1=CC2=C(C=C1[N+](=O)[O-])C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O
InChIKey GYWGQAIDMYGOLU-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 3',6'-Dihydroxy-6-nitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one (CAS: 27402-68-2) typically synthesized?

3',6'-Dihydroxy-6-nitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one (CAS: 27402-68-2) is synthesized t...

Compound Q&A

What industries use 3',6'-Dihydroxy-6-nitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one (CAS: 27402-68-2)?

3',6'-Dihydroxy-6-nitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one (CAS: 27402-68-2) is primarily use...

Compound Q&A

What precautions should be taken when handling 3',6'-Dihydroxy-6-nitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one (CAS: 27402-68-2)?

When handling 3',6'-Dihydroxy-6-nitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one (CAS: 27402-68-2), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...