Compound Q&A

What industries use AGN 194204 Impurity 6 (CAS: 41891-54-7)?

Answer

AGN 194204 Impurity 6
AGN 194204 Impurity 6 (CAS: 41891-54-7) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of complex molecules. It also finds applications in the polymer industry, particularly in the development of advanced materials with specific properties. Additionally, it is utilized in the production of sensor components and in the semiconductor industry for specialized applications requiring high purity materials.

About

CAS No 41891-54-7
English Name AGN 194204 Impurity 6
Molecular Formula C11H21O5P
Molecular Weight 264.26 g/mol
SMILES CCOC(=O)C=C(C)CP(=O)(OCC)OCC
InChIKey OQKGPUSERILONW-CSKARUKUSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of AGN 194204 Impurity 6 (CAS: 41891-54-7)?

AGN 194204 Impurity 6 (CAS: 41891-54-7) is a crystalline compound with a molecular weight of approxi...

Compound Q&A

How is AGN 194204 Impurity 6 (CAS: 41891-54-7) typically synthesized?

AGN 194204 Impurity 6 (CAS: 41891-54-7) is synthesized through a multi-step organic synthesis proces...

Compound Q&A

What precautions should be taken when handling AGN 194204 Impurity 6 (CAS: 41891-54-7)?

When handling AGN 194204 Impurity 6 (CAS: 41891-54-7), it is crucial to use personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...