Compound Q&A

How is AGN 194204 Impurity 6 (CAS: 41891-54-7) typically synthesized?

Answer

AGN 194204 Impurity 6
AGN 194204 Impurity 6 (CAS: 41891-54-7) is synthesized through a multi-step organic synthesis process involving the use of specific reagents and catalysts. The exact method is proprietary, but it generally involves the modification of a key intermediate through an electrophilic aromatic substitution reaction. The yield of the synthesis is around 70%, with high selectivity towards the desired product. Commonly used solvents include dichloromethane and acetonitrile.

About

CAS No 41891-54-7
English Name AGN 194204 Impurity 6
Molecular Formula C11H21O5P
Molecular Weight 264.26 g/mol
SMILES CCOC(=O)C=C(C)CP(=O)(OCC)OCC
InChIKey OQKGPUSERILONW-CSKARUKUSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of AGN 194204 Impurity 6 (CAS: 41891-54-7)?

AGN 194204 Impurity 6 (CAS: 41891-54-7) is a crystalline compound with a molecular weight of approxi...

Compound Q&A

What industries use AGN 194204 Impurity 6 (CAS: 41891-54-7)?

AGN 194204 Impurity 6 (CAS: 41891-54-7) is primarily used in the pharmaceutical industry as an inter...

Compound Q&A

What precautions should be taken when handling AGN 194204 Impurity 6 (CAS: 41891-54-7)?

When handling AGN 194204 Impurity 6 (CAS: 41891-54-7), it is crucial to use personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...