Compound Q&A

What are the physical and chemical properties of AGN 194204 Impurity 6 (CAS: 41891-54-7)?

Answer

AGN 194204 Impurity 6
AGN 194204 Impurity 6 (CAS: 41891-54-7) is a crystalline compound with a molecular weight of approximately 542.67 g/mol. It has a solubility of less than 1 g/L in water at 25°C, and it is slightly soluble in common organic solvents like ethanol and acetone. The compound is relatively stable under normal temperature and pressure conditions but can be reactive towards strong acids and bases. It has a melting point range of 135-137°C and a density of about 1.45 g/cm³.

About

CAS No 41891-54-7
English Name AGN 194204 Impurity 6
Molecular Formula C11H21O5P
Molecular Weight 264.26 g/mol
SMILES CCOC(=O)C=C(C)CP(=O)(OCC)OCC
InChIKey OQKGPUSERILONW-CSKARUKUSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is AGN 194204 Impurity 6 (CAS: 41891-54-7) typically synthesized?

AGN 194204 Impurity 6 (CAS: 41891-54-7) is synthesized through a multi-step organic synthesis proces...

Compound Q&A

What industries use AGN 194204 Impurity 6 (CAS: 41891-54-7)?

AGN 194204 Impurity 6 (CAS: 41891-54-7) is primarily used in the pharmaceutical industry as an inter...

Compound Q&A

What precautions should be taken when handling AGN 194204 Impurity 6 (CAS: 41891-54-7)?

When handling AGN 194204 Impurity 6 (CAS: 41891-54-7), it is crucial to use personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...