Compound Q&A

How is 2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6) typically synthesized?

Answer

2-Bromo-4,5-difluorophenylacetic acid
2-Bromo-4,5-difluorophenylacetic acid can be synthesized by bromination of 4,5-difluorophenylacetic acid using N-bromosuccinimide (NBS) in the presence of a suitable solvent like acetonitrile. The reaction is typically carried out under light or UV irradiation. The yield can be up to 90% with good selectivity towards the bromo substitution.

About

English Name 2-Bromo-4,5-difluorophenylacetic acid
Molecular Formula C8H5BrF2O2
Molecular Weight 251.03 g/mol
SMILES C1=C(C(=CC(=C1F)F)Br)CC(=O)O
InChIKey FQSLXVRCDYUESO-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6)?

2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6) is a white crystalline solid with a molecul...

Compound Q&A

What industries use 2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6)?

2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6) is primarily used in pharmaceuticals for th...

Compound Q&A

What precautions should be taken when handling 2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6)?

When handling 2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6), proper personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...