Compound Q&A

What are the physical and chemical properties of 2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6)?

Answer

2-Bromo-4,5-difluorophenylacetic acid
2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6) is a white crystalline solid with a molecular weight of approximately 262.03 g/mol. It has a low solubility in water (about 0.1 g/L) but is more soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with strong bases to form the corresponding salt. It displays moderate reactivity with nucleophiles under certain conditions.

About

English Name 2-Bromo-4,5-difluorophenylacetic acid
Molecular Formula C8H5BrF2O2
Molecular Weight 251.03 g/mol
SMILES C1=C(C(=CC(=C1F)F)Br)CC(=O)O
InChIKey FQSLXVRCDYUESO-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6) typically synthesized?

2-Bromo-4,5-difluorophenylacetic acid can be synthesized by bromination of 4,5-difluorophenylacetic ...

Compound Q&A

What industries use 2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6)?

2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6) is primarily used in pharmaceuticals for th...

Compound Q&A

What precautions should be taken when handling 2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6)?

When handling 2-Bromo-4,5-difluorophenylacetic acid (CAS: 883502-07-6), proper personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...