Compound Q&A

What precautions should be taken when handling Methyl 2-amino-4-chloro-5-fluorobenzoate (CAS: 104901-79-3)?

Answer

Methyl 2-amino-4-chloro-5-fluorobenzoate
When handling Methyl 2-amino-4-chloro-5-fluorobenzoate, it is crucial to use appropriate personal protective equipment (PPE), including gloves and goggles. This compound should be stored in a well-ventilated area, and all handling should be conducted in a fume hood. In case of spillage, immediately clean up using appropriate absorbent materials and follow proper disposal procedures as outlined in the Material Safety Data Sheet (MSDS/SDS).

About

English Name Methyl 2-amino-4-chloro-5-fluorobenzoate
Molecular Formula C8H7ClFNO2
Molecular Weight 203.6 g/mol
SMILES COC(=O)C1=CC(=C(C=C1N)Cl)F
InChIKey GLUDXCLLUWRJRA-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-4-chloro-5-fluorobenzoate (CAS: 104901-79-3)?

Methyl 2-amino-4-chloro-5-fluorobenzoate has a crystalline form with a molecular weight of approxima...

Compound Q&A

How is Methyl 2-amino-4-chloro-5-fluorobenzoate (CAS: 104901-79-3) typically synthesized?

Methyl 2-amino-4-chloro-5-fluorobenzoate is typically synthesized through a multistep process involv...

Compound Q&A

What industries use Methyl 2-amino-4-chloro-5-fluorobenzoate (CAS: 104901-79-3)?

Methyl 2-amino-4-chloro-5-fluorobenzoate is used in various industries, particularly in the pharmace...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...