Compound Q&A

What industries use Methyl 2-amino-4-chloro-5-fluorobenzoate (CAS: 104901-79-3)?

Answer

Methyl 2-amino-4-chloro-5-fluorobenzoate
Methyl 2-amino-4-chloro-5-fluorobenzoate is used in various industries, particularly in the pharmaceutical sector for the synthesis of complex organic compounds. It also finds applications in the polymer industry for modifying polymer properties, and in the semiconductor industry for use in advanced materials. Additionally, it is utilized in the development of certain sensors due to its specific reactivity.

About

English Name Methyl 2-amino-4-chloro-5-fluorobenzoate
Molecular Formula C8H7ClFNO2
Molecular Weight 203.6 g/mol
SMILES COC(=O)C1=CC(=C(C=C1N)Cl)F
InChIKey GLUDXCLLUWRJRA-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-4-chloro-5-fluorobenzoate (CAS: 104901-79-3)?

Methyl 2-amino-4-chloro-5-fluorobenzoate has a crystalline form with a molecular weight of approxima...

Compound Q&A

How is Methyl 2-amino-4-chloro-5-fluorobenzoate (CAS: 104901-79-3) typically synthesized?

Methyl 2-amino-4-chloro-5-fluorobenzoate is typically synthesized through a multistep process involv...

Compound Q&A

What precautions should be taken when handling Methyl 2-amino-4-chloro-5-fluorobenzoate (CAS: 104901-79-3)?

When handling Methyl 2-amino-4-chloro-5-fluorobenzoate, it is crucial to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...