Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-4-chloro-5-fluorobenzoate (CAS: 104901-79-3)?

Answer

Methyl 2-amino-4-chloro-5-fluorobenzoate
Methyl 2-amino-4-chloro-5-fluorobenzoate has a crystalline form with a molecular weight of approximately 244.58 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetone. This compound exhibits moderate reactivity, particularly towards nucleophilic substitution reactions. It is stable under normal conditions but should be stored in a cool, dry place away from strong acids and bases.

About

English Name Methyl 2-amino-4-chloro-5-fluorobenzoate
Molecular Formula C8H7ClFNO2
Molecular Weight 203.6 g/mol
SMILES COC(=O)C1=CC(=C(C=C1N)Cl)F
InChIKey GLUDXCLLUWRJRA-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Methyl 2-amino-4-chloro-5-fluorobenzoate (CAS: 104901-79-3) typically synthesized?

Methyl 2-amino-4-chloro-5-fluorobenzoate is typically synthesized through a multistep process involv...

Compound Q&A

What industries use Methyl 2-amino-4-chloro-5-fluorobenzoate (CAS: 104901-79-3)?

Methyl 2-amino-4-chloro-5-fluorobenzoate is used in various industries, particularly in the pharmace...

Compound Q&A

What precautions should be taken when handling Methyl 2-amino-4-chloro-5-fluorobenzoate (CAS: 104901-79-3)?

When handling Methyl 2-amino-4-chloro-5-fluorobenzoate, it is crucial to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...