Compound Q&A

What industries use 2-(4-Aminophenyl)butanoic acid (CAS: 29644-97-1)?

Answer

2-(4-Aminophenyl)butanoic acid
2-(4-Aminophenyl)butanoic acid is utilized in various industries. In pharmaceuticals, it serves as a precursor for the synthesis of bioactive compounds. It is also used in the production of polymers, where its amine functionality allows for the formation of specific chemical bonds. Additionally, it has applications in sensors and semiconductors due to its reactive properties and ability to form stable complexes.

About

CAS No 29644-97-1
English Name 2-(4-Aminophenyl)butanoic acid
Molecular Formula C10H13NO2
Molecular Weight 179.22 g/mol
SMILES CCC(C1=CC=C(C=C1)N)C(=O)O
InChIKey WAPLXGPARWRGJO-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Aminophenyl)butanoic acid (CAS: 29644-97-1)?

2-(4-Aminophenyl)butanoic acid is a white crystalline solid with a molecular weight of 221.23 g/mol....

Compound Q&A

How is 2-(4-Aminophenyl)butanoic acid (CAS: 29644-97-1) typically synthesized?

2-(4-Aminophenyl)butanoic acid is commonly synthesized via the condensation of 4-aminophenol with bu...

Compound Q&A

What precautions should be taken when handling 2-(4-Aminophenyl)butanoic acid (CAS: 29644-97-1)?

When handling 2-(4-Aminophenyl)butanoic acid, it is important to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...