Compound Q&A

How is 2-(4-Aminophenyl)butanoic acid (CAS: 29644-97-1) typically synthesized?

Answer

2-(4-Aminophenyl)butanoic acid
2-(4-Aminophenyl)butanoic acid is commonly synthesized via the condensation of 4-aminophenol with butanoic acid in the presence of a catalyst such as p-toluenesulfonic acid. The reaction is typically carried out in an organic solvent like methanol or ethanol. The yield of the product is around 70-80%, and the purity can be increased through recrystallization from hot ethanol.

About

CAS No 29644-97-1
English Name 2-(4-Aminophenyl)butanoic acid
Molecular Formula C10H13NO2
Molecular Weight 179.22 g/mol
SMILES CCC(C1=CC=C(C=C1)N)C(=O)O
InChIKey WAPLXGPARWRGJO-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Aminophenyl)butanoic acid (CAS: 29644-97-1)?

2-(4-Aminophenyl)butanoic acid is a white crystalline solid with a molecular weight of 221.23 g/mol....

Compound Q&A

What industries use 2-(4-Aminophenyl)butanoic acid (CAS: 29644-97-1)?

2-(4-Aminophenyl)butanoic acid is utilized in various industries. In pharmaceuticals, it serves as a...

Compound Q&A

What precautions should be taken when handling 2-(4-Aminophenyl)butanoic acid (CAS: 29644-97-1)?

When handling 2-(4-Aminophenyl)butanoic acid, it is important to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...