Compound Q&A

What industries use 3-Nitrophenylalanine (CAS: 169530-97-6)?

Answer

3-Nitrophenylalanine
3-Nitrophenylalanine is used in the pharmaceutical industry for the synthesis of various bioactive compounds and in the polymer industry for the development of functional polymers. It is also applied in the sensor and semiconductor industries for creating specialized materials with unique properties.

About

English Name 3-Nitrophenylalanine
Molecular Formula C9H10N2O4
Molecular Weight 210.19 g/mol
SMILES C1=CC(=CC(=C1)[N+](=O)[O-])CC(C(=O)O)N
InChIKey YTHDRUZHNYKZGF-MRVPVSSYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Nitrophenylalanine (CAS: 169530-97-6)?

3-Nitrophenylalanine is a crystalline compound with a molecular weight of approximately 244.08 g/mol...

Compound Q&A

How is 3-Nitrophenylalanine (CAS: 169530-97-6) typically synthesized?

3-Nitrophenylalanine is typically synthesized through the nitration of phenylalanine or its derivati...

Compound Q&A

What precautions should be taken when handling 3-Nitrophenylalanine (CAS: 169530-97-6)?

When handling 3-Nitrophenylalanine, it is essential to use personal protective equipment (PPE) such ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...