Compound Q&A

How is 3-Nitrophenylalanine (CAS: 169530-97-6) typically synthesized?

Answer

3-Nitrophenylalanine
3-Nitrophenylalanine is typically synthesized through the nitration of phenylalanine or its derivatives using nitric acid in the presence of sulfuric acid as a catalyst. The reaction conditions include heating to ensure high yields and selectivity, with careful control of temperature and concentration to prevent side reactions.

About

English Name 3-Nitrophenylalanine
Molecular Formula C9H10N2O4
Molecular Weight 210.19 g/mol
SMILES C1=CC(=CC(=C1)[N+](=O)[O-])CC(C(=O)O)N
InChIKey YTHDRUZHNYKZGF-MRVPVSSYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Nitrophenylalanine (CAS: 169530-97-6)?

3-Nitrophenylalanine is a crystalline compound with a molecular weight of approximately 244.08 g/mol...

Compound Q&A

What industries use 3-Nitrophenylalanine (CAS: 169530-97-6)?

3-Nitrophenylalanine is used in the pharmaceutical industry for the synthesis of various bioactive c...

Compound Q&A

What precautions should be taken when handling 3-Nitrophenylalanine (CAS: 169530-97-6)?

When handling 3-Nitrophenylalanine, it is essential to use personal protective equipment (PPE) such ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...