Compound Q&A

What are the physical and chemical properties of 3-Nitrophenylalanine (CAS: 169530-97-6)?

Answer

3-Nitrophenylalanine
3-Nitrophenylalanine is a crystalline compound with a molecular weight of approximately 244.08 g/mol. It has a high solubility in organic solvents like ethanol and acetone but is slightly soluble in water. Chemically, it exhibits typical reactivity of its aromatic and amino functionalities, including nucleophilic substitution and electrophilic aromatic substitution reactions.

About

English Name 3-Nitrophenylalanine
Molecular Formula C9H10N2O4
Molecular Weight 210.19 g/mol
SMILES C1=CC(=CC(=C1)[N+](=O)[O-])CC(C(=O)O)N
InChIKey YTHDRUZHNYKZGF-MRVPVSSYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 3-Nitrophenylalanine (CAS: 169530-97-6) typically synthesized?

3-Nitrophenylalanine is typically synthesized through the nitration of phenylalanine or its derivati...

Compound Q&A

What industries use 3-Nitrophenylalanine (CAS: 169530-97-6)?

3-Nitrophenylalanine is used in the pharmaceutical industry for the synthesis of various bioactive c...

Compound Q&A

What precautions should be taken when handling 3-Nitrophenylalanine (CAS: 169530-97-6)?

When handling 3-Nitrophenylalanine, it is essential to use personal protective equipment (PPE) such ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...