Compound Q&A

What industries use 3-(Trifluoromethyl)benzenecarboximidamide hydrochloride (CAS: 62980-03-4)?

Answer

3-(Trifluoromethyl)benzenecarboximidamide hydrochloride (1:1)
3-(Trifluoromethyl)benzenecarboximidamide hydrochloride finds applications in the pharmaceutical industry for the development of certain drug candidates. It is also used in the synthesis of materials for sensors and semiconductors due to its unique chemical properties. Additionally, it may be employed in polymer chemistry for specific applications requiring trifluoromethyl functionality.

About

CAS No 62980-03-4
English Name 3-(Trifluoromethyl)benzenecarboximidamide hydrochloride (1:1)
Molecular Formula C8H8ClF3N2
Molecular Weight 224.61299999999994 g/mol
SMILES NC(=N)c1cccc(c1)C(F)(F)F.Cl
InChIKey JRWQLKZLTWPEBO-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Trifluoromethyl)benzenecarboximidamide hydrochloride (CAS: 62980-03-4)?

3-(Trifluoromethyl)benzenecarboximidamide hydrochloride is a white crystalline solid with a molecula...

Compound Q&A

How is 3-(Trifluoromethyl)benzenecarboximidamide hydrochloride (CAS: 62980-03-4) typically synthesized?

3-(Trifluoromethyl)benzenecarboximidamide hydrochloride is typically synthesized via the reaction of...

Compound Q&A

What precautions should be taken when handling 3-(Trifluoromethyl)benzenecarboximidamide hydrochloride (CAS: 62980-03-4)?

When handling 3-(Trifluoromethyl)benzenecarboximidamide hydrochloride, it is essential to use person...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA