Compound Q&A

What industries use Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7)?

Answer

Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) is used in the pharmaceutical industry as an intermediate for the synthesis of certain drugs. It is also utilized in the formulation of cosmetics and personal care products due to its solubility and chemical stability.

About

CAS No 58016-28-7

English Name Methyl 2,4-dihydroxy-6-pentylbenzoate

Molecular Formula C13H18O4

Molecular Weight 238.28299999999996 g/mol

SMILES CCCCCC1=C(C(=CC(=C1)O)O)C(=O)OC

InChIKey RQGAOBDPFOADCM-UHFFFAOYSA-N

Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7)?

Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) is a crystalline compound with a molecular w...

Compound Q&A

How is Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) typically synthesized?

Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) is typically synthesized by the esterificati...

Compound Q&A

What precautions should be taken when handling Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7)?

When handling Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7), it is important to use approp...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What industries use Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7)?

Answer

About

Related Q&A

What are the physical and chemical properties of Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7)?

How is Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) typically synthesized?

What precautions should be taken when handling Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7)?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Leyan Reagents

Gansu Hanju Pharmaceutical Co., Ltd.

Hubei Hanwei Chemical Co., Ltd.

HuBeiGuoYunFuRui Technology Co Ltd

Shanghai Yuyeh Biotechnology Co., Ltd.

Hubei Yangxin Pharmaceutical Technology Co., Ltd.