Compound Q&A

What are the physical and chemical properties of Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7)?

Answer

Methyl 2,4-dihydroxy-6-pentylbenzoate
Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) is a crystalline compound with a molecular weight of approximately 262.35 g/mol. It is slightly soluble in water but highly soluble in organic solvents like ethanol and acetone. Chemically, it is reactive towards acidic and basic conditions, and it can undergo ester hydrolysis under certain conditions.

About

CAS No 58016-28-7
English Name Methyl 2,4-dihydroxy-6-pentylbenzoate
Molecular Formula C13H18O4
Molecular Weight 238.28 g/mol
SMILES CCCCCC1=C(C(=CC(=C1)O)O)C(=O)OC
InChIKey RQGAOBDPFOADCM-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) typically synthesized?

Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) is typically synthesized by the esterificati...

Compound Q&A

What industries use Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7)?

Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) is used in the pharmaceutical industry as an...

Compound Q&A

What precautions should be taken when handling Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7)?

When handling Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7), it is important to use approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...